C18H23NO5 — CID 175166884
phenyl prop-2-enoate;N-propan-2-ylprop-2-enamide;prop-2-enoic acid (PubChem CID 175166884) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is phenyl prop-2-enoate;N-propan-2-ylprop-2-enamide;prop-2-enoic acid.
| Compound Name | phenyl prop-2-enoate;N-propan-2-ylprop-2-enamide;prop-2-enoic acid |
|---|---|
| PubChem CID | 175166884 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | phenyl prop-2-enoate;N-propan-2-ylprop-2-enamide;prop-2-enoic acid |
| SMILES | C=CC(=O)NC(C)C.C=CC(=O)O.C=CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C9H8O2.C6H11NO.C3H4O2/c1-2-9(10)11-8-6-4-3-5-7-8;1-4-6(8)7-5(2)3;1-2-3(4)5/h2-7H,1H2;4-5H,1H2,2-3H3,(H,7,8);2H,1H2,(H,4,5) |
| InChIKey | FNINSELPCNSCOK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|