C39H32N12O2 — CID 155065684
[4-[[4-anilino-6-[4-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]phenyl] prop-2-enoate (PubChem CID 155065684) has the molecular formula C39H32N12O2 and a molecular weight of 700.77 g/mol. Its IUPAC name is [4-[[4-anilino-6-[4-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]phenyl] prop-2-enoate.
| Compound Name | [4-[[4-anilino-6-[4-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 155065684 |
| Molecular Formula | C39H32N12O2 |
| Molecular Weight | 700.77 g/mol |
| Exact Mass | 700.28 |
| IUPAC Name | [4-[[4-anilino-6-[4-[(4,6-dianilino-1,3,5-triazin-2-yl)amino]anilino]-1,3,5-triazin-2-yl]amino]phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccc(Nc2nc(Nc3ccccc3)nc(Nc3ccc(Nc4nc(Nc5ccccc5)nc(Nc5ccccc5)n4)cc3)n2)cc1 |
| InChI | InChI=1S/C39H32N12O2/c1-2-33(52)53-32-24-22-31(23-25-32)45-39-50-36(42-28-16-10-5-11-17-28)49-38(51-39)44-30-20-18-29(19-21-30)43-37-47-34(40-26-12-6-3-7-13-26)46-35(48-37)41-27-14-8-4-9-15-27/h2-25H,1H2,(H3,40,41,43,46,47,48)(H3,42,44,45,49,50,51) |
| InChIKey | UBZSLMMAZGKAIH-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 175.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.77 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|