C28H28N6O5 — CID 155065667
2-[3-[[4-anilino-6-[3-(2-hydroxyethoxy)anilino]-1,3,5-triazin-2-yl]amino]phenoxy]ethyl prop-2-enoate (PubChem CID 155065667) has the molecular formula C28H28N6O5 and a molecular weight of 528.57 g/mol. Its IUPAC name is 2-[3-[[4-anilino-6-[3-(2-hydroxyethoxy)anilino]-1,3,5-triazin-2-yl]amino]phenoxy]ethyl prop-2-enoate.
| Compound Name | 2-[3-[[4-anilino-6-[3-(2-hydroxyethoxy)anilino]-1,3,5-triazin-2-yl]amino]phenoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 155065667 |
| Molecular Formula | C28H28N6O5 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 2-[3-[[4-anilino-6-[3-(2-hydroxyethoxy)anilino]-1,3,5-triazin-2-yl]amino]phenoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1cccc(Nc2nc(Nc3ccccc3)nc(Nc3cccc(OCCO)c3)n2)c1 |
| InChI | InChI=1S/C28H28N6O5/c1-2-25(36)39-17-16-38-24-13-7-11-22(19-24)31-28-33-26(29-20-8-4-3-5-9-20)32-27(34-28)30-21-10-6-12-23(18-21)37-15-14-35/h2-13,18-19,35H,1,14-17H2,(H3,29,30,31,32,33,34) |
| InChIKey | YNXVKZLCCBNVIR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 139.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|