C30H32N6O8 — CID 155065581
2-[[4,6-bis[3-(2-prop-2-enoyloxyethoxy)anilino]-1,3,5-triazin-2-yl]amino]ethyl prop-2-enoate (PubChem CID 155065581) has the molecular formula C30H32N6O8 and a molecular weight of 604.62 g/mol. Its IUPAC name is 2-[[4,6-bis[3-(2-prop-2-enoyloxyethoxy)anilino]-1,3,5-triazin-2-yl]amino]ethyl prop-2-enoate.
| Compound Name | 2-[[4,6-bis[3-(2-prop-2-enoyloxyethoxy)anilino]-1,3,5-triazin-2-yl]amino]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 155065581 |
| Molecular Formula | C30H32N6O8 |
| Molecular Weight | 604.62 g/mol |
| Exact Mass | 604.23 |
| IUPAC Name | 2-[[4,6-bis[3-(2-prop-2-enoyloxyethoxy)anilino]-1,3,5-triazin-2-yl]amino]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCNc1nc(Nc2cccc(OCCOC(=O)C=C)c2)nc(Nc2cccc(OCCOC(=O)C=C)c2)n1 |
| InChI | InChI=1S/C30H32N6O8/c1-4-25(37)42-14-13-31-28-34-29(32-21-9-7-11-23(19-21)40-15-17-43-26(38)5-2)36-30(35-28)33-22-10-8-12-24(20-22)41-16-18-44-27(39)6-3/h4-12,19-20H,1-3,13-18H2,(H3,31,32,33,34,35,36) |
| InChIKey | WWGKWLGUHGAUGE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 172.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|