C28H28N6O7 — CID 155065630
[3-[[4,6-bis[3-(hydroxymethoxy)anilino]-1,3,5-triazin-2-yl]amino]phenoxy]methyl 2-methylprop-2-enoate (PubChem CID 155065630) has the molecular formula C28H28N6O7 and a molecular weight of 560.57 g/mol. Its IUPAC name is [3-[[4,6-bis[3-(hydroxymethoxy)anilino]-1,3,5-triazin-2-yl]amino]phenoxy]methyl 2-methylprop-2-enoate.
| Compound Name | [3-[[4,6-bis[3-(hydroxymethoxy)anilino]-1,3,5-triazin-2-yl]amino]phenoxy]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155065630 |
| Molecular Formula | C28H28N6O7 |
| Molecular Weight | 560.57 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | [3-[[4,6-bis[3-(hydroxymethoxy)anilino]-1,3,5-triazin-2-yl]amino]phenoxy]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCOc1cccc(Nc2nc(Nc3cccc(OCO)c3)nc(Nc3cccc(OCO)c3)n2)c1 |
| InChI | InChI=1S/C28H28N6O7/c1-18(2)25(37)41-17-40-24-11-5-8-21(14-24)31-28-33-26(29-19-6-3-9-22(12-19)38-15-35)32-27(34-28)30-20-7-4-10-23(13-20)39-16-36/h3-14,35-36H,1,15-17H2,2H3,(H3,29,30,31,32,33,34) |
| InChIKey | WJGRVAIAHYMYDK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 169.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|