C23H24O8 — CID 66671823
[3-hydroxy-4-(2-hydroxybenzoyl)phenoxy]methyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate (PubChem CID 66671823) has the molecular formula C23H24O8 and a molecular weight of 428.44 g/mol. Its IUPAC name is [3-hydroxy-4-(2-hydroxybenzoyl)phenoxy]methyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate.
| Compound Name | [3-hydroxy-4-(2-hydroxybenzoyl)phenoxy]methyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66671823 |
| Molecular Formula | C23H24O8 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | [3-hydroxy-4-(2-hydroxybenzoyl)phenoxy]methyl 2-methylprop-2-enoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(C)C(=O)OCOc1ccc(C(=O)c2ccccc2O)c(O)c1 |
| InChI | InChI=1S/C18H16O6.C5H8O2/c1-11(2)18(22)24-10-23-12-7-8-14(16(20)9-12)17(21)13-5-3-4-6-15(13)19;1-4(2)5(6)7-3/h3-9,19-20H,1,10H2,2H3;1H2,2-3H3 |
| InChIKey | MINQNXXIVUKJKI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|