C36H38N6O9 — CID 155065633
[4-[[4-[4-[(1-hydroxy-2-methylprop-2-enoxy)methoxy]anilino]-6-[4-(2-methylprop-2-enoyloxymethoxy)anilino]-1,3,5-triazin-2-yl]amino]phenoxy]methyl 2-methylprop-2-enoate (PubChem CID 155065633) has the molecular formula C36H38N6O9 and a molecular weight of 698.73 g/mol. Its IUPAC name is [4-[[4-[4-[(1-hydroxy-2-methylprop-2-enoxy)methoxy]anilino]-6-[4-(2-methylprop-2-enoyloxymethoxy)anilino]-1,3,5-triazin-2-yl]amino]phenoxy]methyl 2-methylprop-2-enoate.
| Compound Name | [4-[[4-[4-[(1-hydroxy-2-methylprop-2-enoxy)methoxy]anilino]-6-[4-(2-methylprop-2-enoyloxymethoxy)anilino]-1,3,5-triazin-2-yl]amino]phenoxy]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155065633 |
| Molecular Formula | C36H38N6O9 |
| Molecular Weight | 698.73 g/mol |
| Exact Mass | 698.27 |
| IUPAC Name | [4-[[4-[4-[(1-hydroxy-2-methylprop-2-enoxy)methoxy]anilino]-6-[4-(2-methylprop-2-enoyloxymethoxy)anilino]-1,3,5-triazin-2-yl]amino]phenoxy]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCOc1ccc(Nc2nc(Nc3ccc(OCOC(=O)C(=C)C)cc3)nc(Nc3ccc(OCOC(O)C(=C)C)cc3)n2)cc1 |
| InChI | InChI=1S/C36H38N6O9/c1-22(2)31(43)49-19-46-28-13-7-25(8-14-28)37-34-40-35(38-26-9-15-29(16-10-26)47-20-50-32(44)23(3)4)42-36(41-34)39-27-11-17-30(18-12-27)48-21-51-33(45)24(5)6/h7-18,31,43H,1,3,5,19-21H2,2,4,6H3,(H3,37,38,39,40,41,42) |
| InChIKey | VJIUMEHOUVPDEO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 184.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|