C24H28O5 — CID 157092996
ethane;[4-[[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]methyl]phenoxy]methyl 2-methylprop-2-enoate (PubChem CID 157092996) has the molecular formula C24H28O5 and a molecular weight of 396.48 g/mol. Its IUPAC name is ethane;[4-[[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]methyl]phenoxy]methyl 2-methylprop-2-enoate.
| Compound Name | ethane;[4-[[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]methyl]phenoxy]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 157092996 |
| Molecular Formula | C24H28O5 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | ethane;[4-[[4-[(E)-3-methoxy-3-oxoprop-1-enyl]phenyl]methyl]phenoxy]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCOc1ccc(Cc2ccc(/C=C/C(=O)OC)cc2)cc1.CC |
| InChI | InChI=1S/C22H22O5.C2H6/c1-16(2)22(24)27-15-26-20-11-8-19(9-12-20)14-18-6-4-17(5-7-18)10-13-21(23)25-3;1-2/h4-13H,1,14-15H2,2-3H3;1-2H3/b13-10+; |
| InChIKey | AEWPQZQQSDUHPN-RSGUCCNWSA-N |
| XLogP | 4.95 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|