C17H18N2O2 — CID 58454499
methyl (E)-3-[4-[(3,5-diaminophenyl)methyl]phenyl]prop-2-enoate (PubChem CID 58454499) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl (E)-3-[4-[(3,5-diaminophenyl)methyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[(3,5-diaminophenyl)methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58454499 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | methyl (E)-3-[4-[(3,5-diaminophenyl)methyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(Cc2cc(N)cc(N)c2)cc1 |
| InChI | InChI=1S/C17H18N2O2/c1-21-17(20)7-6-12-2-4-13(5-3-12)8-14-9-15(18)11-16(19)10-14/h2-7,9-11H,8,18-19H2,1H3/b7-6+ |
| InChIKey | HYKHZOBOKSPMNG-VOTSOKGWSA-N |
| XLogP | 2.63 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|