C19H23N3O8 — CID 158251323
3-[4,6-bis(2-prop-2-enoyloxyethoxy)-1,3,5-triazin-2-yl]propyl prop-2-enoate (PubChem CID 158251323) has the molecular formula C19H23N3O8 and a molecular weight of 421.41 g/mol. Its IUPAC name is 3-[4,6-bis(2-prop-2-enoyloxyethoxy)-1,3,5-triazin-2-yl]propyl prop-2-enoate.
| Compound Name | 3-[4,6-bis(2-prop-2-enoyloxyethoxy)-1,3,5-triazin-2-yl]propyl prop-2-enoate |
|---|---|
| PubChem CID | 158251323 |
| Molecular Formula | C19H23N3O8 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 3-[4,6-bis(2-prop-2-enoyloxyethoxy)-1,3,5-triazin-2-yl]propyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCc1nc(OCCOC(=O)C=C)nc(OCCOC(=O)C=C)n1 |
| InChI | InChI=1S/C19H23N3O8/c1-4-15(23)26-9-7-8-14-20-18(29-12-10-27-16(24)5-2)22-19(21-14)30-13-11-28-17(25)6-3/h4-6H,1-3,7-13H2 |
| InChIKey | XOTMPAVQNAHDFF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 136.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|