C27H29N3O7 — CID 118672397
4-[[4-naphthalen-1-yloxy-6-(4-prop-2-enoyloxybutoxy)-1,3,5-triazin-2-yl]oxy]butyl prop-2-enoate (PubChem CID 118672397) has the molecular formula C27H29N3O7 and a molecular weight of 507.54 g/mol. Its IUPAC name is 4-[[4-naphthalen-1-yloxy-6-(4-prop-2-enoyloxybutoxy)-1,3,5-triazin-2-yl]oxy]butyl prop-2-enoate.
| Compound Name | 4-[[4-naphthalen-1-yloxy-6-(4-prop-2-enoyloxybutoxy)-1,3,5-triazin-2-yl]oxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 118672397 |
| Molecular Formula | C27H29N3O7 |
| Molecular Weight | 507.54 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 4-[[4-naphthalen-1-yloxy-6-(4-prop-2-enoyloxybutoxy)-1,3,5-triazin-2-yl]oxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1nc(OCCCCOC(=O)C=C)nc(Oc2cccc3ccccc23)n1 |
| InChI | InChI=1S/C27H29N3O7/c1-3-23(31)33-16-7-9-18-35-25-28-26(36-19-10-8-17-34-24(32)4-2)30-27(29-25)37-22-15-11-13-20-12-5-6-14-21(20)22/h3-6,11-15H,1-2,7-10,16-19H2 |
| InChIKey | NGUXHQBFUMYMRO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 118.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.54 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|