C8H9N3O5 — CID 68786519
2-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)oxy]ethyl prop-2-enoate (PubChem CID 68786519) has the molecular formula C8H9N3O5 and a molecular weight of 227.18 g/mol. Its IUPAC name is 2-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)oxy]ethyl prop-2-enoate.
| Compound Name | 2-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)oxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 68786519 |
| Molecular Formula | C8H9N3O5 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-[(4,6-dioxo-1H-1,3,5-triazin-2-yl)oxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOc1nc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C8H9N3O5/c1-2-5(12)15-3-4-16-8-10-6(13)9-7(14)11-8/h2H,1,3-4H2,(H2,9,10,11,13,14) |
| InChIKey | JTYAQOQTAQMCBO-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 114.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|