C21H18O5 — CID 54261077
(2-hydroxy-3-prop-2-enoyloxypropyl) anthracene-9-carboxylate (PubChem CID 54261077) has the molecular formula C21H18O5 and a molecular weight of 350.37 g/mol. Its IUPAC name is (2-hydroxy-3-prop-2-enoyloxypropyl) anthracene-9-carboxylate.
| Compound Name | (2-hydroxy-3-prop-2-enoyloxypropyl) anthracene-9-carboxylate |
|---|---|
| PubChem CID | 54261077 |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | (2-hydroxy-3-prop-2-enoyloxypropyl) anthracene-9-carboxylate |
| SMILES | C=CC(=O)OCC(O)COC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C21H18O5/c1-2-19(23)25-12-16(22)13-26-21(24)20-17-9-5-3-7-14(17)11-15-8-4-6-10-18(15)20/h2-11,16,22H,1,12-13H2 |
| InChIKey | RDOAFLZGVFYMSY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|