C31H40O5 — CID 170198676
[3-(2-tert-butyl-2,4,4-trimethylhexanoyl)oxy-2-hydroxypropyl] anthracene-9-carboxylate (PubChem CID 170198676) has the molecular formula C31H40O5 and a molecular weight of 492.66 g/mol. Its IUPAC name is [3-(2-tert-butyl-2,4,4-trimethylhexanoyl)oxy-2-hydroxypropyl] anthracene-9-carboxylate.
| Compound Name | [3-(2-tert-butyl-2,4,4-trimethylhexanoyl)oxy-2-hydroxypropyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 170198676 |
| Molecular Formula | C31H40O5 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | [3-(2-tert-butyl-2,4,4-trimethylhexanoyl)oxy-2-hydroxypropyl] anthracene-9-carboxylate |
| SMILES | CCC(C)(C)CC(C)(C(=O)OCC(O)COC(=O)c1c2ccccc2cc2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C31H40O5/c1-8-30(5,6)20-31(7,29(2,3)4)28(34)36-19-23(32)18-35-27(33)26-24-15-11-9-13-21(24)17-22-14-10-12-16-25(22)26/h9-17,23,32H,8,18-20H2,1-7H3 |
| InChIKey | GXTXJOGHJJDOKV-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|