C23H24O5 — CID 59559105
[2-hydroxy-3-(2-methylbutanoyloxy)propyl] anthracene-9-carboxylate (PubChem CID 59559105) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methylbutanoyloxy)propyl] anthracene-9-carboxylate.
| Compound Name | [2-hydroxy-3-(2-methylbutanoyloxy)propyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 59559105 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [2-hydroxy-3-(2-methylbutanoyloxy)propyl] anthracene-9-carboxylate |
| SMILES | CCC(C)C(=O)OCC(O)COC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C23H24O5/c1-3-15(2)22(25)27-13-18(24)14-28-23(26)21-19-10-6-4-8-16(19)12-17-9-5-7-11-20(17)21/h4-12,15,18,24H,3,13-14H2,1-2H3 |
| InChIKey | GRLSXXRCQCSKRF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|