C32H29N3O9 — CID 129034137
[3-[3-(3-benzoyloxy-2-hydroxypropyl)-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] anthracene-9-carboxylate (PubChem CID 129034137) has the molecular formula C32H29N3O9 and a molecular weight of 599.60 g/mol. Its IUPAC name is [3-[3-(3-benzoyloxy-2-hydroxypropyl)-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] anthracene-9-carboxylate.
| Compound Name | [3-[3-(3-benzoyloxy-2-hydroxypropyl)-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 129034137 |
| Molecular Formula | C32H29N3O9 |
| Molecular Weight | 599.60 g/mol |
| Exact Mass | 599.19 |
| IUPAC Name | [3-[3-(3-benzoyloxy-2-hydroxypropyl)-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] anthracene-9-carboxylate |
| SMILES | Cn1c(=O)n(CC(O)COC(=O)c2ccccc2)c(=O)n(CC(O)COC(=O)c2c3ccccc3cc3ccccc23)c1=O |
| InChI | InChI=1S/C32H29N3O9/c1-33-30(40)34(16-23(36)18-43-28(38)20-9-3-2-4-10-20)32(42)35(31(33)41)17-24(37)19-44-29(39)27-25-13-7-5-11-21(25)15-22-12-6-8-14-26(22)27/h2-15,23-24,36-37H,16-19H2,1H3 |
| InChIKey | GDMFDVLFQWCDHB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 159.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.60 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|