C39H33N3O10 — CID 129034143
[3-[3-(2,3-dibenzoyloxypropyl)-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] anthracene-9-carboxylate (PubChem CID 129034143) has the molecular formula C39H33N3O10 and a molecular weight of 703.70 g/mol. Its IUPAC name is [3-[3-(2,3-dibenzoyloxypropyl)-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] anthracene-9-carboxylate.
| Compound Name | [3-[3-(2,3-dibenzoyloxypropyl)-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 129034143 |
| Molecular Formula | C39H33N3O10 |
| Molecular Weight | 703.70 g/mol |
| Exact Mass | 703.22 |
| IUPAC Name | [3-[3-(2,3-dibenzoyloxypropyl)-5-methyl-2,4,6-trioxo-1,3,5-triazinan-1-yl]-2-hydroxypropyl] anthracene-9-carboxylate |
| SMILES | Cn1c(=O)n(CC(O)COC(=O)c2c3ccccc3cc3ccccc23)c(=O)n(CC(COC(=O)c2ccccc2)OC(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C39H33N3O10/c1-40-37(47)41(21-29(43)23-50-36(46)33-31-18-10-8-16-27(31)20-28-17-9-11-19-32(28)33)39(49)42(38(40)48)22-30(52-35(45)26-14-6-3-7-15-26)24-51-34(44)25-12-4-2-5-13-25/h2-20,29-30,43H,21-24H2,1H3 |
| InChIKey | XUSYKOHYOHDNEB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 165.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.70 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|