C34H36O6 — CID 173428167
[3-[4-(5-but-2-enoyloxy-4-hydroxy-2-methylpentan-2-yl)phenyl]-2-hydroxypropyl] anthracene-9-carboxylate (PubChem CID 173428167) has the molecular formula C34H36O6 and a molecular weight of 540.66 g/mol. Its IUPAC name is [3-[4-(5-but-2-enoyloxy-4-hydroxy-2-methylpentan-2-yl)phenyl]-2-hydroxypropyl] anthracene-9-carboxylate.
| Compound Name | [3-[4-(5-but-2-enoyloxy-4-hydroxy-2-methylpentan-2-yl)phenyl]-2-hydroxypropyl] anthracene-9-carboxylate |
|---|---|
| PubChem CID | 173428167 |
| Molecular Formula | C34H36O6 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | [3-[4-(5-but-2-enoyloxy-4-hydroxy-2-methylpentan-2-yl)phenyl]-2-hydroxypropyl] anthracene-9-carboxylate |
| SMILES | CC=CC(=O)OCC(O)CC(C)(C)c1ccc(CC(O)COC(=O)c2c3ccccc3cc3ccccc23)cc1 |
| InChI | InChI=1S/C34H36O6/c1-4-9-31(37)39-22-28(36)20-34(2,3)26-16-14-23(15-17-26)18-27(35)21-40-33(38)32-29-12-7-5-10-24(29)19-25-11-6-8-13-30(25)32/h4-17,19,27-28,35-36H,18,20-22H2,1-3H3 |
| InChIKey | CUOCENAYYXHFKG-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|