C19H19N3O4 — CID 141331672
[3-[4-(2H-benzotriazol-4-yl)-3-hydroxyphenyl]-2-hydroxypropyl] but-2-enoate (PubChem CID 141331672) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is [3-[4-(2H-benzotriazol-4-yl)-3-hydroxyphenyl]-2-hydroxypropyl] but-2-enoate.
| Compound Name | [3-[4-(2H-benzotriazol-4-yl)-3-hydroxyphenyl]-2-hydroxypropyl] but-2-enoate |
|---|---|
| PubChem CID | 141331672 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | [3-[4-(2H-benzotriazol-4-yl)-3-hydroxyphenyl]-2-hydroxypropyl] but-2-enoate |
| SMILES | CC=CC(=O)OCC(O)Cc1ccc(-c2cccc3n[nH]nc23)c(O)c1 |
| InChI | InChI=1S/C19H19N3O4/c1-2-4-18(25)26-11-13(23)9-12-7-8-14(17(24)10-12)15-5-3-6-16-19(15)21-22-20-16/h2-8,10,13,23-24H,9,11H2,1H3,(H,20,21,22) |
| InChIKey | YTIUJZFXEMNQDP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|