C19H19N3O3 — CID 57163984
3-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]propyl but-2-enoate (PubChem CID 57163984) has the molecular formula C19H19N3O3 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]propyl but-2-enoate.
| Compound Name | 3-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]propyl but-2-enoate |
|---|---|
| PubChem CID | 57163984 |
| Molecular Formula | C19H19N3O3 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | 3-[3-(benzotriazol-2-yl)-4-hydroxyphenyl]propyl but-2-enoate |
| SMILES | CC=CC(=O)OCCCc1ccc(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C19H19N3O3/c1-2-6-19(24)25-12-5-7-14-10-11-18(23)17(13-14)22-20-15-8-3-4-9-16(15)21-22/h2-4,6,8-11,13,23H,5,7,12H2,1H3 |
| InChIKey | OJZHLEVUYHRLQG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|