About 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate
3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate (PubChem CID 67847766) has the molecular formula C19H19N3O5
and a molecular weight of 369.38 g/mol. Its IUPAC name is 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate.
Molecular Properties
| Compound Name | 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate |
| PubChem CID | 67847766 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate |
| SMILES | CC=C(O)C(=O)OCCCOc1ccc(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C19H19N3O5/c1-2-17(23)19(25)27-11-5-10-26-13-8-9-18(24)16(12-13)22-20-14-6-3-4-7-15(14)21-22/h2-4,6-9,12,23-24H,5,10-11H2,1H3 |
| InChIKey | UTYMZIYZZBUWBG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 106.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate?
The IUPAC name of 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate (CID 67847766) is 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate.
What is the SMILES notation for 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate?
The canonical SMILES for 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate is CC=C(O)C(=O)OCCCOc1ccc(O)c(-n2nc3ccccc3n2)c1.
What is the InChIKey of 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate?
The InChIKey is UTYMZIYZZBUWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3O5/c1-2-17(23)19(25)27-11-5-10-26-13-8-9-18(24)16(12-13)22-20-14-6-3-4-7-15(14)21-22/h2-4,6-9,12,23-24H,5,10-11H2,1H3.
What are the key properties of 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate?
3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate has a molecular weight of 369.38 g/mol, XLogP of 2.90, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(benzotriazol-2-yl)-4-hydroxyphenoxy]propyl 2-hydroxybut-2-enoate is sourced from PubChem (CID 67847766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).