C21H21N3O5 — CID 171768525
4-(2-methylprop-2-enoyloxy)butyl 3-(benzotriazol-2-yl)-4-hydroxybenzoate (PubChem CID 171768525) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is 4-(2-methylprop-2-enoyloxy)butyl 3-(benzotriazol-2-yl)-4-hydroxybenzoate.
| Compound Name | 4-(2-methylprop-2-enoyloxy)butyl 3-(benzotriazol-2-yl)-4-hydroxybenzoate |
|---|---|
| PubChem CID | 171768525 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-(2-methylprop-2-enoyloxy)butyl 3-(benzotriazol-2-yl)-4-hydroxybenzoate |
| SMILES | C=C(C)C(=O)OCCCCOC(=O)c1ccc(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C21H21N3O5/c1-14(2)20(26)28-11-5-6-12-29-21(27)15-9-10-19(25)18(13-15)24-22-16-7-3-4-8-17(16)23-24/h3-4,7-10,13,25H,1,5-6,11-12H2,2H3 |
| InChIKey | UUUXBKYWAWDGFA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|