C21H22N4O5 — CID 171768648
[6-[3-(benzotriazol-2-yl)-4-hydroxyanilino]-6-oxohexyl] 2-oxopropanoate (PubChem CID 171768648) has the molecular formula C21H22N4O5 and a molecular weight of 410.43 g/mol. Its IUPAC name is [6-[3-(benzotriazol-2-yl)-4-hydroxyanilino]-6-oxohexyl] 2-oxopropanoate.
| Compound Name | [6-[3-(benzotriazol-2-yl)-4-hydroxyanilino]-6-oxohexyl] 2-oxopropanoate |
|---|---|
| PubChem CID | 171768648 |
| Molecular Formula | C21H22N4O5 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | [6-[3-(benzotriazol-2-yl)-4-hydroxyanilino]-6-oxohexyl] 2-oxopropanoate |
| SMILES | CC(=O)C(=O)OCCCCCC(=O)Nc1ccc(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C21H22N4O5/c1-14(26)21(29)30-12-6-2-3-9-20(28)22-15-10-11-19(27)18(13-15)25-23-16-7-4-5-8-17(16)24-25/h4-5,7-8,10-11,13,27H,2-3,6,9,12H2,1H3,(H,22,28) |
| InChIKey | NAWBZBUKLMIGJW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|