C27H38N4O2S — CID 166031535
N-[3-hydroxy-4-(5-octylsulfanylbenzotriazol-2-yl)phenyl]heptanamide (PubChem CID 166031535) has the molecular formula C27H38N4O2S and a molecular weight of 482.69 g/mol. Its IUPAC name is N-[3-hydroxy-4-(5-octylsulfanylbenzotriazol-2-yl)phenyl]heptanamide.
| Compound Name | N-[3-hydroxy-4-(5-octylsulfanylbenzotriazol-2-yl)phenyl]heptanamide |
|---|---|
| PubChem CID | 166031535 |
| Molecular Formula | C27H38N4O2S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | N-[3-hydroxy-4-(5-octylsulfanylbenzotriazol-2-yl)phenyl]heptanamide |
| SMILES | CCCCCCCCSc1ccc2nn(-c3ccc(NC(=O)CCCCCC)cc3O)nc2c1 |
| InChI | InChI=1S/C27H38N4O2S/c1-3-5-7-9-10-12-18-34-22-15-16-23-24(20-22)30-31(29-23)25-17-14-21(19-26(25)32)28-27(33)13-11-8-6-4-2/h14-17,19-20,32H,3-13,18H2,1-2H3,(H,28,33) |
| InChIKey | BCOIZOBFAGLKOT-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|