C18H19ClN4O2 — CID 166031560
N-[4-(5-chlorobenzotriazol-2-yl)-3-hydroxyphenyl]-2,2-dimethylbutanamide (PubChem CID 166031560) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is N-[4-(5-chlorobenzotriazol-2-yl)-3-hydroxyphenyl]-2,2-dimethylbutanamide.
| Compound Name | N-[4-(5-chlorobenzotriazol-2-yl)-3-hydroxyphenyl]-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 166031560 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | N-[4-(5-chlorobenzotriazol-2-yl)-3-hydroxyphenyl]-2,2-dimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)Nc1ccc(-n2nc3ccc(Cl)cc3n2)c(O)c1 |
| InChI | InChI=1S/C18H19ClN4O2/c1-4-18(2,3)17(25)20-12-6-8-15(16(24)10-12)23-21-13-7-5-11(19)9-14(13)22-23/h5-10,24H,4H2,1-3H3,(H,20,25) |
| InChIKey | IVIUAXPXIXRPOZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |