C13H17NO4 — CID 55102860
4-(2,2-dimethylbutanoylamino)-2-hydroxybenzoic acid (PubChem CID 55102860) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-(2,2-dimethylbutanoylamino)-2-hydroxybenzoic acid.
| Compound Name | 4-(2,2-dimethylbutanoylamino)-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 55102860 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-(2,2-dimethylbutanoylamino)-2-hydroxybenzoic acid |
| SMILES | CCC(C)(C)C(=O)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C13H17NO4/c1-4-13(2,3)12(18)14-8-5-6-9(11(16)17)10(15)7-8/h5-7,15H,4H2,1-3H3,(H,14,18)(H,16,17) |
| InChIKey | UBKRTZRZBCEHSN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |