C12H12BrNO5 — CID 102492608
4-[(2-bromo-2-methylpropanoyl)amino]phthalic acid (PubChem CID 102492608) has the molecular formula C12H12BrNO5 and a molecular weight of 330.13 g/mol. Its IUPAC name is 4-[(2-bromo-2-methylpropanoyl)amino]phthalic acid.
| Compound Name | 4-[(2-bromo-2-methylpropanoyl)amino]phthalic acid |
|---|---|
| PubChem CID | 102492608 |
| Molecular Formula | C12H12BrNO5 |
| Molecular Weight | 330.13 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 4-[(2-bromo-2-methylpropanoyl)amino]phthalic acid |
| SMILES | CC(C)(Br)C(=O)Nc1ccc(C(=O)O)c(C(=O)O)c1 |
| InChI | InChI=1S/C12H12BrNO5/c1-12(2,13)11(19)14-6-3-4-7(9(15)16)8(5-6)10(17)18/h3-5H,1-2H3,(H,14,19)(H,15,16)(H,17,18) |
| InChIKey | JHBKMMKNZMSTQB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.13 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|