C11H11BrFNO3 — CID 114327952
5-[(2-bromo-2-methylpropanoyl)amino]-2-fluorobenzoic acid (PubChem CID 114327952) has the molecular formula C11H11BrFNO3 and a molecular weight of 304.12 g/mol. Its IUPAC name is 5-[(2-bromo-2-methylpropanoyl)amino]-2-fluorobenzoic acid.
| Compound Name | 5-[(2-bromo-2-methylpropanoyl)amino]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 114327952 |
| Molecular Formula | C11H11BrFNO3 |
| Molecular Weight | 304.12 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 5-[(2-bromo-2-methylpropanoyl)amino]-2-fluorobenzoic acid |
| SMILES | CC(C)(Br)C(=O)Nc1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C11H11BrFNO3/c1-11(2,12)10(17)14-6-3-4-8(13)7(5-6)9(15)16/h3-5H,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | YVSIOYJTLSDYEW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.12 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|