C11H10BrF2NO3 — CID 116816927
2-bromo-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylpropanamide (PubChem CID 116816927) has the molecular formula C11H10BrF2NO3 and a molecular weight of 322.11 g/mol. Its IUPAC name is 2-bromo-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylpropanamide.
| Compound Name | 2-bromo-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylpropanamide |
|---|---|
| PubChem CID | 116816927 |
| Molecular Formula | C11H10BrF2NO3 |
| Molecular Weight | 322.11 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 2-bromo-N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2-methylpropanamide |
| SMILES | CC(C)(Br)C(=O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C11H10BrF2NO3/c1-10(2,12)9(16)15-6-3-4-7-8(5-6)18-11(13,14)17-7/h3-5H,1-2H3,(H,15,16) |
| InChIKey | TYJXABULUXQURE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.11 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|