C10H7F2NO5 — CID 112616624
methyl 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoacetate (PubChem CID 112616624) has the molecular formula C10H7F2NO5 and a molecular weight of 259.16 g/mol. Its IUPAC name is methyl 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoacetate.
| Compound Name | methyl 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoacetate |
|---|---|
| PubChem CID | 112616624 |
| Molecular Formula | C10H7F2NO5 |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | methyl 2-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]-2-oxoacetate |
| SMILES | COC(=O)C(=O)Nc1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C10H7F2NO5/c1-16-9(15)8(14)13-5-2-3-6-7(4-5)18-10(11,12)17-6/h2-4H,1H3,(H,13,14) |
| InChIKey | NYHGYYWMJCNEKH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|