C17H15F2NO6 — CID 26954091
N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,3,4-trimethoxybenzamide (PubChem CID 26954091) has the molecular formula C17H15F2NO6 and a molecular weight of 367.30 g/mol. Its IUPAC name is N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,3,4-trimethoxybenzamide.
| Compound Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,3,4-trimethoxybenzamide |
|---|---|
| PubChem CID | 26954091 |
| Molecular Formula | C17H15F2NO6 |
| Molecular Weight | 367.30 g/mol |
| Exact Mass | 367.09 |
| IUPAC Name | N-(2,2-difluoro-1,3-benzodioxol-5-yl)-2,3,4-trimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc3c(c2)OC(F)(F)O3)c(OC)c1OC |
| InChI | InChI=1S/C17H15F2NO6/c1-22-12-7-5-10(14(23-2)15(12)24-3)16(21)20-9-4-6-11-13(8-9)26-17(18,19)25-11/h4-8H,1-3H3,(H,20,21) |
| InChIKey | BOYFSJPYNVYKAT-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.30 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |