C20H23NO6 — CID 16766246
N-(2-ethyl-2-methyl-1,3-benzodioxol-5-yl)-3,4,5-trimethoxybenzamide (PubChem CID 16766246) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is N-(2-ethyl-2-methyl-1,3-benzodioxol-5-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(2-ethyl-2-methyl-1,3-benzodioxol-5-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 16766246 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N-(2-ethyl-2-methyl-1,3-benzodioxol-5-yl)-3,4,5-trimethoxybenzamide |
| SMILES | CCC1(C)Oc2ccc(NC(=O)c3cc(OC)c(OC)c(OC)c3)cc2O1 |
| InChI | InChI=1S/C20H23NO6/c1-6-20(2)26-14-8-7-13(11-15(14)27-20)21-19(22)12-9-16(23-3)18(25-5)17(10-12)24-4/h7-11H,6H2,1-5H3,(H,21,22) |
| InChIKey | KKBLQPDYEMOCBI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |