C20H25NO6 — CID 26435232
3,4,5-trimethoxy-N-(3-methoxy-4-propan-2-yloxyphenyl)benzamide (PubChem CID 26435232) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(3-methoxy-4-propan-2-yloxyphenyl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(3-methoxy-4-propan-2-yloxyphenyl)benzamide |
|---|---|
| PubChem CID | 26435232 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | 3,4,5-trimethoxy-N-(3-methoxy-4-propan-2-yloxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2cc(OC)c(OC)c(OC)c2)ccc1OC(C)C |
| InChI | InChI=1S/C20H25NO6/c1-12(2)27-15-8-7-14(11-16(15)23-3)21-20(22)13-9-17(24-4)19(26-6)18(10-13)25-5/h7-12H,1-6H3,(H,21,22) |
| InChIKey | XNEFVJOEKNAWNI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |