C18H21NO5 — CID 91676904
N-[4-(1-hydroxyethyl)phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 91676904) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is N-[4-(1-hydroxyethyl)phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-(1-hydroxyethyl)phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 91676904 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[4-(1-hydroxyethyl)phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C(C)O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C18H21NO5/c1-11(20)12-5-7-14(8-6-12)19-18(21)13-9-15(22-2)17(24-4)16(10-13)23-3/h5-11,20H,1-4H3,(H,19,21) |
| InChIKey | YVBWOEFFMKHXDG-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |