C22H27NO6 — CID 55727633
N-(2,2-dimethyl-1,3-benzodioxol-5-yl)-3,4,5-triethoxybenzamide (PubChem CID 55727633) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is N-(2,2-dimethyl-1,3-benzodioxol-5-yl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(2,2-dimethyl-1,3-benzodioxol-5-yl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 55727633 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-(2,2-dimethyl-1,3-benzodioxol-5-yl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2ccc3c(c2)OC(C)(C)O3)cc(OCC)c1OCC |
| InChI | InChI=1S/C22H27NO6/c1-6-25-18-11-14(12-19(26-7-2)20(18)27-8-3)21(24)23-15-9-10-16-17(13-15)29-22(4,5)28-16/h9-13H,6-8H2,1-5H3,(H,23,24) |
| InChIKey | ZOAUOROPNSVJGD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |