C23H19NO4 — CID 1327317
4-benzoyl-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)benzamide (PubChem CID 1327317) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 4-benzoyl-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)benzamide.
| Compound Name | 4-benzoyl-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)benzamide |
|---|---|
| PubChem CID | 1327317 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 4-benzoyl-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)benzamide |
| SMILES | CC1(C)Oc2ccc(NC(=O)c3ccc(C(=O)c4ccccc4)cc3)cc2O1 |
| InChI | InChI=1S/C23H19NO4/c1-23(2)27-19-13-12-18(14-20(19)28-23)24-22(26)17-10-8-16(9-11-17)21(25)15-6-4-3-5-7-15/h3-14H,1-2H3,(H,24,26) |
| InChIKey | MCLWEMXBJGVXNN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |