C19H19NO3 — CID 26173901
3-methyl-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide (PubChem CID 26173901) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 3-methyl-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide.
| Compound Name | 3-methyl-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide |
|---|---|
| PubChem CID | 26173901 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | 3-methyl-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc3c(c2)OC2(CCCC2)O3)c1 |
| InChI | InChI=1S/C19H19NO3/c1-13-5-4-6-14(11-13)18(21)20-15-7-8-16-17(12-15)23-19(22-16)9-2-3-10-19/h4-8,11-12H,2-3,9-10H2,1H3,(H,20,21) |
| InChIKey | BOVGJSRFIJXFCA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |