C18H16INO3 — CID 26757516
2-iodo-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide (PubChem CID 26757516) has the molecular formula C18H16INO3 and a molecular weight of 421.23 g/mol. Its IUPAC name is 2-iodo-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide.
| Compound Name | 2-iodo-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide |
|---|---|
| PubChem CID | 26757516 |
| Molecular Formula | C18H16INO3 |
| Molecular Weight | 421.23 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 2-iodo-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide |
| SMILES | O=C(Nc1ccc2c(c1)OC1(CCCC1)O2)c1ccccc1I |
| InChI | InChI=1S/C18H16INO3/c19-14-6-2-1-5-13(14)17(21)20-12-7-8-15-16(11-12)23-18(22-15)9-3-4-10-18/h1-2,5-8,11H,3-4,9-10H2,(H,20,21) |
| InChIKey | NCTDLPNWRUCYET-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.23 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|