C17H16N2O3S — CID 36599096
N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl-2-sulfanylidene-1H-pyridine-3-carboxamide (PubChem CID 36599096) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl-2-sulfanylidene-1H-pyridine-3-carboxamide.
| Compound Name | N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl-2-sulfanylidene-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 36599096 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-yl-2-sulfanylidene-1H-pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OC1(CCCC1)O2)c1ccc[nH]c1=S |
| InChI | InChI=1S/C17H16N2O3S/c20-15(12-4-3-9-18-16(12)23)19-11-5-6-13-14(10-11)22-17(21-13)7-1-2-8-17/h3-6,9-10H,1-2,7-8H2,(H,18,23)(H,19,20) |
| InChIKey | IVCSHOAEMUUTPJ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|