C17H15ClN2O3 — CID 26757505
2-chloro-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylpyridine-3-carboxamide (PubChem CID 26757505) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is 2-chloro-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylpyridine-3-carboxamide.
| Compound Name | 2-chloro-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 26757505 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-chloro-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OC1(CCCC1)O2)c1cccnc1Cl |
| InChI | InChI=1S/C17H15ClN2O3/c18-15-12(4-3-9-19-15)16(21)20-11-5-6-13-14(10-11)23-17(22-13)7-1-2-8-17/h3-6,9-10H,1-2,7-8H2,(H,20,21) |
| InChIKey | VGTJAOSNDORSJK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|