C20H21NO4 — CID 42280414
2-ethoxy-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide (PubChem CID 42280414) has the molecular formula C20H21NO4 and a molecular weight of 339.39 g/mol. Its IUPAC name is 2-ethoxy-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide.
| Compound Name | 2-ethoxy-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide |
|---|---|
| PubChem CID | 42280414 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 2-ethoxy-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylbenzamide |
| SMILES | CCOc1ccccc1C(=O)Nc1ccc2c(c1)OC1(CCCC1)O2 |
| InChI | InChI=1S/C20H21NO4/c1-2-23-16-8-4-3-7-15(16)19(22)21-14-9-10-17-18(13-14)25-20(24-17)11-5-6-12-20/h3-4,7-10,13H,2,5-6,11-12H2,1H3,(H,21,22) |
| InChIKey | FPKWBQCHMHXMDA-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |