C21H23NO5 — CID 29293162
2,3-dimethoxy-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylbenzamide (PubChem CID 29293162) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 2,3-dimethoxy-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylbenzamide.
| Compound Name | 2,3-dimethoxy-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylbenzamide |
|---|---|
| PubChem CID | 29293162 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 2,3-dimethoxy-N-spiro[1,3-benzodioxole-2,1'-cyclohexane]-5-ylbenzamide |
| SMILES | COc1cccc(C(=O)Nc2ccc3c(c2)OC2(CCCCC2)O3)c1OC |
| InChI | InChI=1S/C21H23NO5/c1-24-17-8-6-7-15(19(17)25-2)20(23)22-14-9-10-16-18(13-14)27-21(26-16)11-4-3-5-12-21/h6-10,13H,3-5,11-12H2,1-2H3,(H,22,23) |
| InChIKey | GZXQEFBNTCTTCT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |