C20H22N2O5 — CID 55997077
2-(2-methoxyethoxy)-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylpyridine-3-carboxamide (PubChem CID 55997077) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-(2-methoxyethoxy)-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylpyridine-3-carboxamide.
| Compound Name | 2-(2-methoxyethoxy)-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 55997077 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 2-(2-methoxyethoxy)-N-spiro[1,3-benzodioxole-2,1'-cyclopentane]-5-ylpyridine-3-carboxamide |
| SMILES | COCCOc1ncccc1C(=O)Nc1ccc2c(c1)OC1(CCCC1)O2 |
| InChI | InChI=1S/C20H22N2O5/c1-24-11-12-25-19-15(5-4-10-21-19)18(23)22-14-6-7-16-17(13-14)27-20(26-16)8-2-3-9-20/h4-7,10,13H,2-3,8-9,11-12H2,1H3,(H,22,23) |
| InChIKey | QNUQTBGJPMJCNP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|