C15H12N2O5S — CID 146648080
N-[(2,2-dihydroxy-1,3-benzodioxol-5-yl)carbamothioyl]benzamide (PubChem CID 146648080) has the molecular formula C15H12N2O5S and a molecular weight of 332.34 g/mol. Its IUPAC name is N-[(2,2-dihydroxy-1,3-benzodioxol-5-yl)carbamothioyl]benzamide.
| Compound Name | N-[(2,2-dihydroxy-1,3-benzodioxol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 146648080 |
| Molecular Formula | C15H12N2O5S |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-[(2,2-dihydroxy-1,3-benzodioxol-5-yl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc2c(c1)OC(O)(O)O2)c1ccccc1 |
| InChI | InChI=1S/C15H12N2O5S/c18-13(9-4-2-1-3-5-9)17-14(23)16-10-6-7-11-12(8-10)22-15(19,20)21-11/h1-8,19-20H,(H2,16,17,18,23) |
| InChIKey | BTQPJABUNQBZIL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|