C18H18N4O2S2 — CID 1314274
N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]benzamide (PubChem CID 1314274) has the molecular formula C18H18N4O2S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1314274 |
| Molecular Formula | C18H18N4O2S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-[[4-(propanoylcarbamothioylamino)phenyl]carbamothioyl]benzamide |
| SMILES | CCC(=O)NC(=S)Nc1ccc(NC(=S)NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H18N4O2S2/c1-2-15(23)21-17(25)19-13-8-10-14(11-9-13)20-18(26)22-16(24)12-6-4-3-5-7-12/h3-11H,2H2,1H3,(H2,19,21,23,25)(H2,20,22,24,26) |
| InChIKey | RLWFMLFVYYAAOA-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|