C19H16N2OS — CID 102194985
N-[(4-cyclopenta-2,4-dien-1-ylphenyl)carbamothioyl]benzamide (PubChem CID 102194985) has the molecular formula C19H16N2OS and a molecular weight of 320.42 g/mol. Its IUPAC name is N-[(4-cyclopenta-2,4-dien-1-ylphenyl)carbamothioyl]benzamide.
| Compound Name | N-[(4-cyclopenta-2,4-dien-1-ylphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 102194985 |
| Molecular Formula | C19H16N2OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | N-[(4-cyclopenta-2,4-dien-1-ylphenyl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(C2C=CC=C2)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2OS/c22-18(16-8-2-1-3-9-16)21-19(23)20-17-12-10-15(11-13-17)14-6-4-5-7-14/h1-14H,(H2,20,21,22,23) |
| InChIKey | REBKJFHVYHHLGZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|