C16H17N3O3S — CID 28638533
N-(furan-2-ylmethyl)-4-(propanoylcarbamothioylamino)benzamide (PubChem CID 28638533) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(propanoylcarbamothioylamino)benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(propanoylcarbamothioylamino)benzamide |
|---|---|
| PubChem CID | 28638533 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(propanoylcarbamothioylamino)benzamide |
| SMILES | CCC(=O)NC(=S)Nc1ccc(C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C16H17N3O3S/c1-2-14(20)19-16(23)18-12-7-5-11(6-8-12)15(21)17-10-13-4-3-9-22-13/h3-9H,2,10H2,1H3,(H,17,21)(H2,18,19,20,23) |
| InChIKey | GESAWEZATDPBBU-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|