C21H19N3O3S — CID 28638553
N-[[4-(furan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]-2-methylbenzamide (PubChem CID 28638553) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is N-[[4-(furan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]-2-methylbenzamide.
| Compound Name | N-[[4-(furan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 28638553 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[[4-(furan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC(=S)Nc1ccc(C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C21H19N3O3S/c1-14-5-2-3-7-18(14)20(26)24-21(28)23-16-10-8-15(9-11-16)19(25)22-13-17-6-4-12-27-17/h2-12H,13H2,1H3,(H,22,25)(H2,23,24,26,28) |
| InChIKey | BIPWXFXNJKMTPT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|