C21H18IN3O3S — CID 4938606
N-[[2-(furan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]-3-iodo-4-methylbenzamide (PubChem CID 4938606) has the molecular formula C21H18IN3O3S and a molecular weight of 519.36 g/mol. Its IUPAC name is N-[[2-(furan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]-3-iodo-4-methylbenzamide.
| Compound Name | N-[[2-(furan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]-3-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 4938606 |
| Molecular Formula | C21H18IN3O3S |
| Molecular Weight | 519.36 g/mol |
| Exact Mass | 519.01 |
| IUPAC Name | N-[[2-(furan-2-ylmethylcarbamoyl)phenyl]carbamothioyl]-3-iodo-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)NCc2ccco2)cc1I |
| InChI | InChI=1S/C21H18IN3O3S/c1-13-8-9-14(11-17(13)22)19(26)25-21(29)24-18-7-3-2-6-16(18)20(27)23-12-15-5-4-10-28-15/h2-11H,12H2,1H3,(H,23,27)(H2,24,25,26,29) |
| InChIKey | GEBLHPHUZKWSJZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|