C24H22IN3O3S — CID 4941693
N-[[2-[(4-ethoxyphenyl)carbamoyl]phenyl]carbamothioyl]-3-iodo-4-methylbenzamide (PubChem CID 4941693) has the molecular formula C24H22IN3O3S and a molecular weight of 559.43 g/mol. Its IUPAC name is N-[[2-[(4-ethoxyphenyl)carbamoyl]phenyl]carbamothioyl]-3-iodo-4-methylbenzamide.
| Compound Name | N-[[2-[(4-ethoxyphenyl)carbamoyl]phenyl]carbamothioyl]-3-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 4941693 |
| Molecular Formula | C24H22IN3O3S |
| Molecular Weight | 559.43 g/mol |
| Exact Mass | 559.04 |
| IUPAC Name | N-[[2-[(4-ethoxyphenyl)carbamoyl]phenyl]carbamothioyl]-3-iodo-4-methylbenzamide |
| SMILES | CCOc1ccc(NC(=O)c2ccccc2NC(=S)NC(=O)c2ccc(C)c(I)c2)cc1 |
| InChI | InChI=1S/C24H22IN3O3S/c1-3-31-18-12-10-17(11-13-18)26-23(30)19-6-4-5-7-21(19)27-24(32)28-22(29)16-9-8-15(2)20(25)14-16/h4-14H,3H2,1-2H3,(H,26,30)(H2,27,28,29,32) |
| InChIKey | HIEWUMMVAWNRDA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.43 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|